CAS 364621-46-5 is the registry number for TFCP2L1-IN-1, 99.66%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 10mM/1mL, 5 mg, 100 mg, 25 mg.
3-bromo-N-[(2-methylphenyl)carbamothioyl]benzamide (CAS 364621-46-5) is a chemical compound with the molecular formula C15H13BrN2OS and a molecular weight of 349.2 g/mol. IUPAC name: 3-bromo-N-[(2-methylphenyl)carbamothioyl]benzamide. InChIKey: HEGLZZCJRVMIDM-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2OS |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 3-bromo-N-[(2-methylphenyl)carbamothioyl]benzamide |
| InChIKey | HEGLZZCJRVMIDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=S)NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)