CAS 36476-80-9 appears in our catalog under these names: 1-Benzhydrylazetidin-3-yl 4-methylbenzenesulfonate, 95%, 95%, 1-Benzhydrylazetidin-3-yl 4-methylbenzenesulfonate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(1-benzhydrylazetidin-3-yl) 4-methylbenzenesulfonate (CAS 36476-80-9) is a chemical compound with the molecular formula C23H23NO3S and a molecular weight of 393.5 g/mol. IUPAC name: (1-benzhydrylazetidin-3-yl) 4-methylbenzenesulfonate. InChIKey: GMFIVTJDNKVZIG-UHFFFAOYSA-N.
| Molecular formula | C23H23NO3S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (1-benzhydrylazetidin-3-yl) 4-methylbenzenesulfonate |
| InChIKey | GMFIVTJDNKVZIG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)