CAS 36525-64-1 is the registry number for Perfluoro-2,5-diazahexane-2,5-dioxyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,1,2,2-tetrafluoro-N,N'-bis(trifluoromethyl)ethane-1,2-diamine oxide (CAS 36525-64-1) is a chemical compound with the molecular formula C4H2F10N2O2 and a molecular weight of 300.05 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-N,N'-bis(trifluoromethyl)ethane-1,2-diamine oxide. InChIKey: JOCGSTNZUZIDMO-UHFFFAOYSA-N.
| Molecular formula | C4H2F10N2O2 |
|---|---|
| Molecular weight | 300.05 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-N,N'-bis(trifluoromethyl)ethane-1,2-diamine oxide |
| InChIKey | JOCGSTNZUZIDMO-UHFFFAOYSA-N |
| SMILES | C(C([NH+](C(F)(F)F)[O-])(F)F)([NH+](C(F)(F)F)[O-])(F)F |
Computed by PubChem (NCBI)