Products 365512-60-3
CAS 365512-60-3 is the registry number for tert-butyl N-[(2S)-3-hydroxy-2-phenyl-propyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(2S)-3-hydroxy-2-phenylpropyl]carbamate (CAS 365512-60-3) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-[(2S)-3-hydroxy-2-phenylpropyl]carbamate. InChIKey: GVWMKFBBAJMCBC-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-3-hydroxy-2-phenylpropyl]carbamate |
| InChIKey | GVWMKFBBAJMCBC-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)