CAS 36554-89-9 appears in our catalog under these names: Aluminium trifluoroacetate, 95%, Aluminium trifluoroacetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 10g, 1g, 100g.
Bis[(2,2,2-trifluoroacetyl)oxy]alumanyl 2,2,2-trifluoroacetate (CAS 36554-89-9) is a chemical compound with the molecular formula C6AlF9O6 and a molecular weight of 366.03 g/mol. IUPAC name: bis[(2,2,2-trifluoroacetyl)oxy]alumanyl 2,2,2-trifluoroacetate. InChIKey: FJYDXYVSFFWRER-UHFFFAOYSA-K.
| Molecular formula | C6AlF9O6 |
|---|---|
| Molecular weight | 366.03 g/mol |
| IUPAC name | bis[(2,2,2-trifluoroacetyl)oxy]alumanyl 2,2,2-trifluoroacetate |
| InChIKey | FJYDXYVSFFWRER-UHFFFAOYSA-K |
| SMILES | C(=O)(C(F)(F)F)O[Al](OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
Computed by PubChem (NCBI)