CAS 36576-42-8 appears in our catalog under these names: Cyanazine Amide, >95% (HPLC), Cyanazine amide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 250mg.
2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanamide (CAS 36576-42-8) is a chemical compound with the molecular formula C9H15ClN6O and a molecular weight of 258.71 g/mol. IUPAC name: 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanamide. InChIKey: YUBYWFQJZICYNO-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN6O |
|---|---|
| Molecular weight | 258.71 g/mol |
| IUPAC name | 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanamide |
| InChIKey | YUBYWFQJZICYNO-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=N1)Cl)NC(C)(C)C(=O)N |
Computed by PubChem (NCBI)