Products 36576-44-0
CAS 36576-44-0 appears in our catalog under these names: Terbuthylazine Metabolite GS40436 LM4, Concentration: 100 µg/ml Solvent: Acetonitrile/Water 50/50, Terbuthylazine Metabolite GS40436 LM4, Concentration: 10 µg/ml Solvent: Acetonitrile/Water 50/50. Offered by: HPC Standards. Available pack sizes: 1x1ml, 1x5ml.
2-[[4-(ethylamino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid (CAS 36576-44-0) is a chemical compound with the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. IUPAC name: 2-[[4-(ethylamino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid. InChIKey: AXUUYNNVNOSTRP-UHFFFAOYSA-N.
| Molecular formula | C9H15N5O3 |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 2-[[4-(ethylamino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid |
| InChIKey | AXUUYNNVNOSTRP-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=O)NC(=N1)NC(C)(C)C(=O)O |
Computed by PubChem (NCBI)