CAS 36593-26-7 is the registry number for alpha-Bromo-2,3,4,5,6-pentachlorotoluene. Offered by: TRC. Available pack sizes: 100mg.
1-(bromomethyl)-2,3,4,5,6-pentachlorobenzene (CAS 36593-26-7) is a chemical compound with the molecular formula C7H2BrCl5 and a molecular weight of 343.3 g/mol. IUPAC name: 1-(bromomethyl)-2,3,4,5,6-pentachlorobenzene. InChIKey: XVDXYWLCPJLCDE-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl5 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,4,5,6-pentachlorobenzene |
| InChIKey | XVDXYWLCPJLCDE-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)Br |
Computed by PubChem (NCBI)