CAS 365996-21-0 appears in our catalog under these names: rel-tert-Butyl ((1R,2R)-2-aminocyclopentyl)carbamate 97%, rel-1,1-Dimethylethyl N-[(1R,2R)-2-aminocyclopentyl]carbamate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate (CAS 365996-21-0) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate. InChIKey: PAXDIBGWURAVIH-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate |
| InChIKey | PAXDIBGWURAVIH-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1N |
Computed by PubChem (NCBI)