CAS 365997-67-7 appears in our catalog under these names: Edoxaban Impurity 95, Edoxaban Impurity 101. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,4S)-4-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 365997-67-7) is a chemical compound with the molecular formula C12H20N4O4 and a molecular weight of 284.31 g/mol. IUPAC name: (1S,3R,4S)-4-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QDFFKJKUQSIDOG-XHNCKOQMSA-N.
| Molecular formula | C12H20N4O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (1S,3R,4S)-4-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QDFFKJKUQSIDOG-XHNCKOQMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)