CAS 365998-97-6 is the registry number for Edoxaban Impurity 73. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (1S,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxycyclohexane-1-carboxylate (CAS 365998-97-6) is a chemical compound with the molecular formula C15H27NO7S and a molecular weight of 365.4 g/mol. IUPAC name: ethyl (1S,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxycyclohexane-1-carboxylate. InChIKey: REERHKRKNNLBKG-QJPTWQEYSA-N.
| Molecular formula | C15H27NO7S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | ethyl (1S,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxycyclohexane-1-carboxylate |
| InChIKey | REERHKRKNNLBKG-QJPTWQEYSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H]([C@@H](C1)NC(=O)OC(C)(C)C)OS(=O)(=O)C |
Computed by PubChem (NCBI)