CAS 36616-60-1 appears in our catalog under these names: (1R,4R,6R)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptan-2-one, 95%, (R,R,R)-Carvone Epoxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(1R,4R,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one (CAS 36616-60-1) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: (1R,4R,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one. InChIKey: YGMNGQDLUQECTO-SFGNSQDASA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (1R,4R,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one |
| InChIKey | YGMNGQDLUQECTO-SFGNSQDASA-N |
| SMILES | CC(=C)[C@@H]1C[C@@H]2[C@@](O2)(C(=O)C1)C |
Computed by PubChem (NCBI)