CAS 36625-57-7 appears in our catalog under these names: 3-Nitro-6-pyridinemethanol 97%, 5-Nitro-2-pyridinemethanol, 97%, 97%, (5-Nitropyridin-2-yl)methanol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(5-nitro-2-pyridinyl)methanol (CAS 36625-57-7) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: (5-nitro-2-pyridinyl)methanol. InChIKey: SUYQFFRZOVQBAS-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | (5-nitro-2-pyridinyl)methanol |
| InChIKey | SUYQFFRZOVQBAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])CO |
Computed by PubChem (NCBI)