CAS 36625-58-8 is the registry number for 2-Methyl-5-nitropyridin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-5-nitropyridin-3-ol (CAS 36625-58-8) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-methyl-5-nitropyridin-3-ol. InChIKey: DKODSKBRWBZZOS-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-methyl-5-nitropyridin-3-ol |
| InChIKey | DKODSKBRWBZZOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)