Products 36626-19-4
CAS 36626-19-4 appears in our catalog under these names: Calophyllic acid, Calophyllic acid. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxo-2,3-dihydropyrano[2,3-h]chromen-6-yl)-3-phenylprop-2-enoic acid (CAS 36626-19-4) is a chemical compound with the molecular formula C25H24O6 and a molecular weight of 420.5 g/mol. IUPAC name: 3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxo-2,3-dihydropyrano[2,3-h]chromen-6-yl)-3-phenylprop-2-enoic acid. InChIKey: SSJOJPHKKKSPGS-UHFFFAOYSA-N.
| Molecular formula | C25H24O6 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxo-2,3-dihydropyrano[2,3-h]chromen-6-yl)-3-phenylprop-2-enoic acid |
| InChIKey | SSJOJPHKKKSPGS-UHFFFAOYSA-N |
| SMILES | CC1C(OC2=C3C=CC(OC3=C(C(=C2C1=O)O)C(=CC(=O)O)C4=CC=CC=C4)(C)C)C |
Computed by PubChem (NCBI)