CAS 3663-50-1 appears in our catalog under these names: Simethicone Impurity 3 , Simethicone Impurity 12, Simethicone Impurity 3, 1,1,3,3,5,5-Hexamethyltrisiloxane-1,5-diol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Bis[[hydroxy(dimethyl)silyl]oxy]-dimethylsilane (CAS 3663-50-1) is a chemical compound with the molecular formula C6H20O4Si3 and a molecular weight of 240.48 g/mol. IUPAC name: bis[[hydroxy(dimethyl)silyl]oxy]-dimethylsilane. InChIKey: XYBQTTAROZGWOZ-UHFFFAOYSA-N.
| Molecular formula | C6H20O4Si3 |
|---|---|
| Molecular weight | 240.48 g/mol |
| IUPAC name | bis[[hydroxy(dimethyl)silyl]oxy]-dimethylsilane |
| InChIKey | XYBQTTAROZGWOZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O)O[Si](C)(C)O[Si](C)(C)O |
Computed by PubChem (NCBI)