CAS 366444-83-9 is the registry number for PDE5-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[(6-methoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione (CAS 366444-83-9) is a chemical compound with the molecular formula C21H23N5O3 and a molecular weight of 393.4 g/mol. IUPAC name: 8-[(6-methoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione. InChIKey: NMTKJEZOWHRAQY-UHFFFAOYSA-N.
| Molecular formula | C21H23N5O3 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 8-[(6-methoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
| InChIKey | NMTKJEZOWHRAQY-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C2=C(C(=O)N(C1=O)C)NC(=N2)CC3=C4C=C(C=CC4=CN=C3)OC |
Computed by PubChem (NCBI)