CAS 36646-14-7 is the registry number for 2-(5-(Pyridin-4-yl)-4H-1,2,4-triazol-3-yl)pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyrazine (CAS 36646-14-7) is a chemical compound with the molecular formula C11H8N6 and a molecular weight of 224.22 g/mol. IUPAC name: 2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyrazine. InChIKey: DMINXODFXULDAT-UHFFFAOYSA-N.
| Molecular formula | C11H8N6 |
|---|---|
| Molecular weight | 224.22 g/mol |
| IUPAC name | 2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyrazine |
| InChIKey | DMINXODFXULDAT-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NNC(=N2)C3=NC=CN=C3 |
Computed by PubChem (NCBI)