Products 36687-82-8
CAS 36687-82-8 appears in our catalog under these names: L-Carnitine-L-Tartrate, L-Carnitine-L-tartrate, >95% (HPLC), L–Carnitine Tartrate, L-Carnitine L-Tartrate, >98.0%(T), Carnitine tartrate. Offered by: Chemat Brand, TRC, GLPBio, TCI, Biosynth. Available pack sizes: on request, 100mg, 500mg, 50mg, 500g, 5g, 25g, 0,5kg.
Bis([(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium);(2R,3R)-2,3-dihydroxybutanedioate (CAS 36687-82-8) is a chemical compound with the molecular formula C18H36N2O12 and a molecular weight of 472.5 g/mol. IUPAC name: bis([(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium);(2R,3R)-2,3-dihydroxybutanedioate. InChIKey: GADIJPCDIWZEMB-BTNVMJJCSA-N.
| Molecular formula | C18H36N2O12 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | bis([(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium);(2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | GADIJPCDIWZEMB-BTNVMJJCSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)O.C[N+](C)(C)C[C@@H](CC(=O)O)O.[C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O |
Computed by PubChem (NCBI)