CAS 3669-74-7 appears in our catalog under these names: N-Methylacetamide-d7, 99 atom % D, min 97% Chemical Purity, N-METHYLACETAMIDE-D7, 98 ATOM % D, N-Methylacetamide-d7. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 1 g.
N,2,2,2-tetradeuterio-N-(trideuteriomethyl)acetamide (CAS 3669-74-7) is a chemical compound with the molecular formula C3H7NO and a molecular weight of 80.14 g/mol. IUPAC name: N,2,2,2-tetradeuterio-N-(trideuteriomethyl)acetamide. InChIKey: OHLUUHNLEMFGTQ-KBKLHOFPSA-N.
| Molecular formula | C3H7NO |
|---|---|
| Molecular weight | 80.14 g/mol |
| IUPAC name | N,2,2,2-tetradeuterio-N-(trideuteriomethyl)acetamide |
| InChIKey | OHLUUHNLEMFGTQ-KBKLHOFPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)