CAS 36709-95-2 appears in our catalog under these names: Ethanone, 2-chloro-1-(1h-indol-2-yl)-, 95%, 2-Chloro-1-(1H-indol-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-chloro-1-(1H-indol-2-yl)ethanone (CAS 36709-95-2) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 2-chloro-1-(1H-indol-2-yl)ethanone. InChIKey: FGNVLOKUUCLSCE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 2-chloro-1-(1H-indol-2-yl)ethanone |
| InChIKey | FGNVLOKUUCLSCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)CCl |
Computed by PubChem (NCBI)