CAS 36715-85-2 is the registry number for 1,1-Dioxidotetrahydrothiophen-3-yl 4-methylbenzenesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 10g.
(1,1-dioxothiolan-3-yl) 4-methylbenzenesulfonate (CAS 36715-85-2) is a chemical compound with the molecular formula C11H14O5S2 and a molecular weight of 290.4 g/mol. IUPAC name: (1,1-dioxothiolan-3-yl) 4-methylbenzenesulfonate. InChIKey: HPFWDJBLUMEKKP-UHFFFAOYSA-N.
| Molecular formula | C11H14O5S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (1,1-dioxothiolan-3-yl) 4-methylbenzenesulfonate |
| InChIKey | HPFWDJBLUMEKKP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)