Products 36725-26-5
CAS 36725-26-5 appears in our catalog under these names: Levosimendan Impurity 43, Levosimendan Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-acetamidophenyl)-3-methyl-4-oxobutanoic acid (CAS 36725-26-5) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 4-(4-acetamidophenyl)-3-methyl-4-oxobutanoic acid. InChIKey: OLJROCDVDZVLNU-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 4-(4-acetamidophenyl)-3-methyl-4-oxobutanoic acid |
| InChIKey | OLJROCDVDZVLNU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)C(=O)C1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)