CAS 367280-99-7 is the registry number for 2-Mesitylpyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trimethylphenyl)pyrrolidine (CAS 367280-99-7) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)pyrrolidine. InChIKey: HSOKRIPAFJFIRN-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)pyrrolidine |
| InChIKey | HSOKRIPAFJFIRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2CCCN2)C |
Computed by PubChem (NCBI)