CAS 3675-63-6 appears in our catalog under these names: Bromoethane-d5, >95% (GC), Bromoethane-d5, 99 atom % D, min 98% Chemical Purity, Bromoethane–d5, BROMOETHANE-D5, 99 ATOM % D. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g.
1-bromo-1,1,2,2,2-pentadeuterioethane (CAS 3675-63-6) is a chemical compound with the molecular formula C2H5Br and a molecular weight of 114.00 g/mol. IUPAC name: 1-bromo-1,1,2,2,2-pentadeuterioethane. InChIKey: RDHPKYGYEGBMSE-ZBJDZAJPSA-N.
| Molecular formula | C2H5Br |
|---|---|
| Molecular weight | 114.00 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,2-pentadeuterioethane |
| InChIKey | RDHPKYGYEGBMSE-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)