CAS 36769-16-1 appears in our catalog under these names: (1R,3R,5S)-3-Phenyl-8-azabicyclo(3.2.1)octane hydrochloride, 95%, rac-(1R,3R,5S)-3-Phenyl-8-azabicyclo(3.2.1)octane hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1R,5S)-3-phenyl-8-azabicyclo[3.2.1]octane;hydrochloride (CAS 36769-16-1) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 223.74 g/mol. IUPAC name: (1R,5S)-3-phenyl-8-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: HLEFOZHDLIDURS-XCJHQLQTSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | (1R,5S)-3-phenyl-8-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | HLEFOZHDLIDURS-XCJHQLQTSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)