CAS 36770-53-3 appears in our catalog under these names: Topiroxostat Impurity 21, Topiroxostat Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-hydroxy-4-(5-pyridin-4-yl-1,2,4-triazol-3-ylidene)pyridine (CAS 36770-53-3) is a chemical compound with the molecular formula C12H9N5O and a molecular weight of 239.23 g/mol. IUPAC name: 1-hydroxy-4-(5-pyridin-4-yl-1,2,4-triazol-3-ylidene)pyridine. InChIKey: SLDPUWPRJTUTMJ-UHFFFAOYSA-N.
| Molecular formula | C12H9N5O |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 1-hydroxy-4-(5-pyridin-4-yl-1,2,4-triazol-3-ylidene)pyridine |
| InChIKey | SLDPUWPRJTUTMJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=C3C=CN(C=C3)O)N=N2 |
Computed by PubChem (NCBI)