CAS 367909-40-8 appears in our catalog under these names: MRS2279, 99+%, MRS 2279, MRS 2279, MRS2279. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 1g, 1 mg.
[(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (CAS 367909-40-8) is a chemical compound with the molecular formula C13H18ClN5O8P2 and a molecular weight of 469.71 g/mol. IUPAC name: [(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate. InChIKey: NDCFGYFBDZLTJB-SMWKGLLFSA-N.
| Molecular formula | C13H18ClN5O8P2 |
|---|---|
| Molecular weight | 469.71 g/mol |
| IUPAC name | [(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| InChIKey | NDCFGYFBDZLTJB-SMWKGLLFSA-N |
| SMILES | CNC1=C2C(=NC(=N1)Cl)N(C=N2)[C@H]3C[C@@H]([C@]4([C@@H]3C4)COP(=O)(O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)