CAS 367927-39-7 appears in our catalog under these names: N-Succinimidyl 6-(3-maleimidopropionamido) hexanoate, 95%, SMPH Crosslinker, Mal-PrHx-NHS, N-Succinimidyl 6-(3-maleimidopropionamido) hexanoate, SMPH (SUCCINIMIDYL 6-((BETA-MALEIMIDOPRO. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 5g, 1g, 100mg, 25mg, 0,1g, 0,05g, 0,25g.
(2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate (CAS 367927-39-7) is a chemical compound with the molecular formula C17H21N3O7 and a molecular weight of 379.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate. InChIKey: WCMOHMXWOOBVMZ-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O7 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
| InChIKey | WCMOHMXWOOBVMZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCNC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)