CAS 368-66-1 appears in our catalog under these names: 2,4,6-tris(Trifluoromethyl)-1,3,5-triazine, >95% (HPLC), 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine, 98% , 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine, 2,4,6-TRIS(TRIFLUOROMETHYL)-1,3,5-TRIAZ&, 2,4,6-TRIS(TRIFLUOROMETHYL)-1,3,5-TRIAZI. Offered by: TRC, Thermo Scientific (Alfa Aesar), Chemat, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,4,6-tris(trifluoromethyl)-1,3,5-triazine (CAS 368-66-1) is a chemical compound with the molecular formula C6F9N3 and a molecular weight of 285.07 g/mol. IUPAC name: 2,4,6-tris(trifluoromethyl)-1,3,5-triazine. InChIKey: LSGBKABSSSIRJF-UHFFFAOYSA-N.
| Molecular formula | C6F9N3 |
|---|---|
| Molecular weight | 285.07 g/mol |
| IUPAC name | 2,4,6-tris(trifluoromethyl)-1,3,5-triazine |
| InChIKey | LSGBKABSSSIRJF-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)C(F)(F)F)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)