Products 36809-65-1

CAS 36809-65-1 appears in our catalog under these names: 1,3-Dichloropropane-2-sulfonyl chloride, 95%, 1,3-Dichloropropane-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1,3-dichloropropane-2-sulfonyl chloride (CAS 36809-65-1) is a chemical compound with the molecular formula C3H5Cl3O2S and a molecular weight of 211.5 g/mol. IUPAC name: 1,3-dichloropropane-2-sulfonyl chloride. InChIKey: DGLQTOLSPYYWES-UHFFFAOYSA-N.

Identity
Molecular formulaC3H5Cl3O2S
Molecular weight211.5 g/mol
IUPAC name1,3-dichloropropane-2-sulfonyl chloride
InChIKeyDGLQTOLSPYYWES-UHFFFAOYSA-N
SMILESC(C(CCl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)