CAS 36840-10-5 appears in our catalog under these names: LPA2 antagonist 2, LPA2 antagonist 2, 95+%, LPA2 antagonist 2, 4,4'-([1,1'-Biphenyl]-4,4'-diylbis(azanediyl))bis(4-oxobut-2-enoic acid), 95%+, 95%+, LPA2 antagonist 2, 95.0%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 100mg, 1mg, 25mg, 50mg, 50 mg, 25 mg.
(E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-enoic acid (CAS 36840-10-5) is a chemical compound with the molecular formula C20H16N2O6 and a molecular weight of 380.3 g/mol. IUPAC name: (E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-enoic acid. InChIKey: FTLRWRKPUWMOMS-WGDLNXRISA-N.
| Molecular formula | C20H16N2O6 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | (E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-enoic acid |
| InChIKey | FTLRWRKPUWMOMS-WGDLNXRISA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)NC(=O)/C=C/C(=O)O)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)