Products 368422-26-8

CAS 368422-26-8 is the registry number for 2-(Methoxymethoxy)-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(methoxymethoxy)-3-(trifluoromethyl)benzoic acid (CAS 368422-26-8) is a chemical compound with the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. IUPAC name: 2-(methoxymethoxy)-3-(trifluoromethyl)benzoic acid. InChIKey: BAVALBGJMHWKLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3O4
Molecular weight250.17 g/mol
IUPAC name2-(methoxymethoxy)-3-(trifluoromethyl)benzoic acid
InChIKeyBAVALBGJMHWKLJ-UHFFFAOYSA-N
SMILESCOCOC1=C(C=CC=C1C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)