CAS 368434-78-0 is the registry number for PB01. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione (CAS 368434-78-0) is a chemical compound with the molecular formula C18H21N5O3 and a molecular weight of 355.4 g/mol. IUPAC name: 7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione. InChIKey: UCNPEYHYXBMSRJ-UHFFFAOYSA-N.
| Molecular formula | C18H21N5O3 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione |
| InChIKey | UCNPEYHYXBMSRJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)N3CCOCC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)