CAS 369-57-3 appears in our catalog under these names: Benzenediazonium Tetrafluoroborate, Benzenediazonium,tetrafluoroborate, Benzenediazonium tetrafluoroborate, 97%, 97%. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 0,1g, 0,05g, 0,25g, 0,5g, 1g, 100mg, 250mg.
Benzenediazonium tetrafluoroborate (CAS 369-57-3) is a chemical compound with the molecular formula C6H5BF4N2 and a molecular weight of 191.92 g/mol. IUPAC name: benzenediazonium tetrafluoroborate. InChIKey: JNCLVGMBRSKDED-UHFFFAOYSA-N.
| Molecular formula | C6H5BF4N2 |
|---|---|
| Molecular weight | 191.92 g/mol |
| IUPAC name | benzenediazonium tetrafluoroborate |
| InChIKey | JNCLVGMBRSKDED-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[N+]#N |
Computed by PubChem (NCBI)