CAS 36916-18-4 appears in our catalog under these names: 7-Chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline, 97%, 97%, 7-Chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline (CAS 36916-18-4) is a chemical compound with the molecular formula C17H12ClN3 and a molecular weight of 293.7 g/mol. IUPAC name: 7-chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline. InChIKey: YTBXDJDBTGZLRK-UHFFFAOYSA-N.
| Molecular formula | C17H12ClN3 |
|---|---|
| Molecular weight | 293.7 g/mol |
| IUPAC name | 7-chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline |
| InChIKey | YTBXDJDBTGZLRK-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)