CAS 36919-02-5 is the registry number for Perfluorophenyl carbonochloridate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2,3,4,5,6-pentafluorophenyl) carbonochloridate (CAS 36919-02-5) is a chemical compound with the molecular formula C7ClF5O2 and a molecular weight of 246.52 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) carbonochloridate. InChIKey: PQBYMIGEEFVPNG-UHFFFAOYSA-N.
| Molecular formula | C7ClF5O2 |
|---|---|
| Molecular weight | 246.52 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) carbonochloridate |
| InChIKey | PQBYMIGEEFVPNG-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)OC(=O)Cl |
Computed by PubChem (NCBI)