CAS 36923-19-0 is the registry number for 7-ANCB Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 36923-19-0) is a chemical compound with the molecular formula C28H24N2O4S and a molecular weight of 484.6 g/mol. IUPAC name: benzhydryl (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: WLBRAOUZRDZACO-SHQCIBLASA-N.
| Molecular formula | C28H24N2O4S |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | benzhydryl (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | WLBRAOUZRDZACO-SHQCIBLASA-N |
| SMILES | C1C=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)OC(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)