CAS 36930-64-0 is the registry number for N-(Iodoacetylaminoethyl)-8-naphthylamine-1-sulfonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonic acid (CAS 36930-64-0) is a chemical compound with the molecular formula C14H15IN2O4S and a molecular weight of 434.25 g/mol. IUPAC name: 8-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonic acid. InChIKey: ZDIHEEHLFMMPKM-UHFFFAOYSA-N.
| Molecular formula | C14H15IN2O4S |
|---|---|
| Molecular weight | 434.25 g/mol |
| IUPAC name | 8-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonic acid |
| InChIKey | ZDIHEEHLFMMPKM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NCCNC(=O)CI)C(=CC=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)