CAS 36944-85-1 appears in our catalog under these names: Pyridoxine Impurity 20, Panadoxine P. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 10mg, 5mg, 50mg.
(2-hydroxy-8-methyl-2-oxo-4H-[1,3,2]dioxaphosphinino[4,5-c]pyridin-5-yl)methanol (CAS 36944-85-1) is a chemical compound with the molecular formula C8H10NO5P and a molecular weight of 231.14 g/mol. IUPAC name: (2-hydroxy-8-methyl-2-oxo-4H-[1,3,2]dioxaphosphinino[4,5-c]pyridin-5-yl)methanol. InChIKey: AKWWLTUICPVQSH-UHFFFAOYSA-N.
| Molecular formula | C8H10NO5P |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | (2-hydroxy-8-methyl-2-oxo-4H-[1,3,2]dioxaphosphinino[4,5-c]pyridin-5-yl)methanol |
| InChIKey | AKWWLTUICPVQSH-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C2=C1OP(=O)(OC2)O)CO |
Computed by PubChem (NCBI)