Products 369606-71-3
CAS 369606-71-3 is the registry number for Antituberculosis agent-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate (CAS 369606-71-3) is a chemical compound with the molecular formula C21H20BrN3O4S and a molecular weight of 490.4 g/mol. IUPAC name: ethyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate. InChIKey: XEYANNMNRFTJKP-UHFFFAOYSA-N.
| Molecular formula | C21H20BrN3O4S |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | ethyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate |
| InChIKey | XEYANNMNRFTJKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C=C21)OC(=O)C)Br)C3=CC=CC=C3)CSC(=N)N |
Computed by PubChem (NCBI)