CAS 36978-49-1 appears in our catalog under these names: 5-(4-Chlorophenyl)-5-oxopentanoic acid 97%, 5-(4-Chlorophenyl)-5-oxopentanoic acid, 97%, 97%, 5-(4-Chlorophenyl)-5-oxovaleric acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-(4-chlorophenyl)-5-oxopentanoate (CAS 36978-49-1) is a chemical compound with the molecular formula C11H10ClO3- and a molecular weight of 225.65 g/mol. IUPAC name: 5-(4-chlorophenyl)-5-oxopentanoate. InChIKey: BVLILROMUFYKGH-UHFFFAOYSA-M.
| Molecular formula | C11H10ClO3- |
|---|---|
| Molecular weight | 225.65 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-5-oxopentanoate |
| InChIKey | BVLILROMUFYKGH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)CCCC(=O)[O-])Cl |
Computed by PubChem (NCBI)