CAS 370-69-4 appears in our catalog under these names: Tris(2,2,2-trifluoroethyl) phosphite, 95%, Tris(2,2,2-trifluoroethyl)-Phosphite, Tris(2,2,2-trifluoroethyl) Phosphite, >98.0%(GC), Tris(2,2,2-trifluoroethyl) phosphite 98%, TRIS(2,2,2-TRIFLUOROETHYL) PHOSPHITE, 9. Offered by: Combi-blocks, Chemat Brand, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 1g, 5g, 25g, on request, 10g, 15g, 50g.
Tris(2,2,2-trifluoroethyl) phosphite (CAS 370-69-4) is a chemical compound with the molecular formula C6H6F9O3P and a molecular weight of 328.07 g/mol. IUPAC name: tris(2,2,2-trifluoroethyl) phosphite. InChIKey: CBIQXUBDNNXYJM-UHFFFAOYSA-N.
| Molecular formula | C6H6F9O3P |
|---|---|
| Molecular weight | 328.07 g/mol |
| IUPAC name | tris(2,2,2-trifluoroethyl) phosphite |
| InChIKey | CBIQXUBDNNXYJM-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OP(OCC(F)(F)F)OCC(F)(F)F |
Computed by PubChem (NCBI)