Products 370096-57-4
CAS 370096-57-4 appears in our catalog under these names: ROS kinases-IN-1/ 97.36% (existing batch purity), ROS kinases–IN–1, ROS kinases-IN-1, ≥98%, ≥98%, ROS kinases-IN-1, 98.30%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg.
(4Z)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-methyl-1H-pyrazol-5-one (CAS 370096-57-4) is a chemical compound with the molecular formula C20H16N4O and a molecular weight of 328.4 g/mol. IUPAC name: (4Z)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-methyl-1H-pyrazol-5-one. InChIKey: DGSFFYVACCJJGR-PDGQHHTCSA-N.
| Molecular formula | C20H16N4O |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (4Z)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-methyl-1H-pyrazol-5-one |
| InChIKey | DGSFFYVACCJJGR-PDGQHHTCSA-N |
| SMILES | CC\1=NNC(=O)/C1=C\C2=CN(N=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)