CAS 370096-67-6 is the registry number for 5-(4-Chlorophenyl)-1H-pyrazole-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-chlorophenyl)-1H-pyrazole-5-carbohydrazide (CAS 370096-67-6) is a chemical compound with the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. IUPAC name: 3-(4-chlorophenyl)-1H-pyrazole-5-carbohydrazide. InChIKey: CSHLSZFCPXYIAM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4O |
|---|---|
| Molecular weight | 236.66 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1H-pyrazole-5-carbohydrazide |
| InChIKey | CSHLSZFCPXYIAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=C2)C(=O)NN)Cl |
Computed by PubChem (NCBI)