CAS 37013-20-0 is the registry number for 3-(Trimethylsilyl)propionic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 1g.
Sodium 3-(trimethylsilyl)propionate is an organic sodium salt composed of sodium and 3-(trimethylsilyl)propionate ions in a 1:1 ratio. It is used as internal reference in the NMR spectrum nuclear magnetic resonance for aqueous solvents (e.g. D2O). It contains a 3-(trimethylsilyl)propionate.
Source: ChEBI
| Molecular formula | C6H13NaO2Si |
|---|---|
| Molecular weight | 168.24 g/mol |
| IUPAC name | sodium 3-trimethylsilylpropanoate |
| InChIKey | OIIWPAYIXDCDNL-UHFFFAOYSA-M |
| SMILES | C[Si](C)(C)CCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)