CAS 3702-98-5 appears in our catalog under these names: Ethyl 4,4,4-trichloro-3-oxobutanoate, 98%, Ethyl 4,4,4-trichloroacetoacetate, 95%, Ethyl 4,4,4–Trichloroacetoacetate, Ethyl 4,4,4-Trichloroacetoacetate, Ethyl 4,4,4-Trichloroacetoacetate, >97.0%(GC). Offered by: AmBeed, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 10g, 2g.
Ethyl 4,4,4-trichloro-3-oxobutanoate (CAS 3702-98-5) is a chemical compound with the molecular formula C6H7Cl3O3 and a molecular weight of 233.5 g/mol. IUPAC name: ethyl 4,4,4-trichloro-3-oxobutanoate. InChIKey: XGIRWPYENXRJMZ-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl3O3 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | ethyl 4,4,4-trichloro-3-oxobutanoate |
| InChIKey | XGIRWPYENXRJMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)