Products 37021-32-2

CAS 37021-32-2 is the registry number for 1,2,2-Trichloro-1,2-difluoroethyl methyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,1,2-trichloro-1,2-difluoro-2-methoxyethane (CAS 37021-32-2) is a chemical compound with the molecular formula C3H3Cl3F2O and a molecular weight of 199.41 g/mol. IUPAC name: 1,1,2-trichloro-1,2-difluoro-2-methoxyethane. InChIKey: OBEMXOBUAQYSRL-UHFFFAOYSA-N.

Identity
Molecular formulaC3H3Cl3F2O
Molecular weight199.41 g/mol
IUPAC name1,1,2-trichloro-1,2-difluoro-2-methoxyethane
InChIKeyOBEMXOBUAQYSRL-UHFFFAOYSA-N
SMILESCOC(C(F)(Cl)Cl)(F)Cl

Computed by PubChem (NCBI)