Products 37021-34-4

CAS 37021-34-4 is the registry number for 1,2,2,2-Tetrachloro-1-fluoroethyl methyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,1,1,2-tetrachloro-2-fluoro-2-methoxyethane (CAS 37021-34-4) is a chemical compound with the molecular formula C3H3Cl4FO and a molecular weight of 215.9 g/mol. IUPAC name: 1,1,1,2-tetrachloro-2-fluoro-2-methoxyethane. InChIKey: WMHOLVCTBNVLOE-UHFFFAOYSA-N.

Identity
Molecular formulaC3H3Cl4FO
Molecular weight215.9 g/mol
IUPAC name1,1,1,2-tetrachloro-2-fluoro-2-methoxyethane
InChIKeyWMHOLVCTBNVLOE-UHFFFAOYSA-N
SMILESCOC(C(Cl)(Cl)Cl)(F)Cl

Computed by PubChem (NCBI)