CAS 37038-69-0 is the registry number for 6-Bromo-1,2,3,4-tetraphenylnaphthalene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1,2,3,4-tetraphenylnaphthalene (CAS 37038-69-0) is a chemical compound with the molecular formula C34H23Br and a molecular weight of 511.4 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetraphenylnaphthalene. InChIKey: VZMGTYFFGJDKIJ-UHFFFAOYSA-N.
| Molecular formula | C34H23Br |
|---|---|
| Molecular weight | 511.4 g/mol |
| IUPAC name | 6-bromo-1,2,3,4-tetraphenylnaphthalene |
| InChIKey | VZMGTYFFGJDKIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C3=C2C=CC(=C3)Br)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)